CAS 89112-86-7
:6-Bromo-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one
Description:
6-Bromo-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one, with the CAS number 89112-86-7, is a synthetic organic compound belonging to the class of flavonoids. This compound features a benzopyran core structure, which is characterized by a fused benzene and pyran ring. The presence of a bromine atom at the 6-position and a methoxyphenyl group at the 2-position contributes to its unique chemical properties and potential biological activities. The methoxy group enhances its lipophilicity, potentially influencing its solubility and reactivity. This compound may exhibit various pharmacological properties, including antioxidant and anti-inflammatory activities, making it of interest in medicinal chemistry. Its structural characteristics suggest potential applications in drug development, particularly in targeting specific biological pathways. As with many synthetic compounds, its stability, reactivity, and interactions with biological systems would be critical areas for further research to fully understand its potential uses and effects.
Formula:C16H11BrO3
InChI:InChI=1S/C16H11BrO3/c1-19-12-5-2-10(3-6-12)16-9-14(18)13-8-11(17)4-7-15(13)20-16/h2-9H,1H3
InChI key:InChIKey=SCFZEMYVTLMMMZ-UHFFFAOYSA-N
SMILES:O=C1C=C(OC=2C1=CC(Br)=CC2)C3=CC=C(OC)C=C3
Synonyms:- 4H-1-Benzopyran-4-one, 6-bromo-2-(4-methoxyphenyl)-
- Flavone, 6-bromo-4′-methoxy-
- 6-Bromo-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one
- 6-Bromo-4′-methoxyflavone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
