CymitQuimica logo

CAS 89113-21-3

:

4-[[(4-Methylphenyl)amino]sulfonyl]benzoic acid hydrazide

Description:
4-[[(4-Methylphenyl)amino]sulfonyl]benzoic acid hydrazide, identified by its CAS number 89113-21-3, is a chemical compound characterized by its sulfonamide and hydrazide functional groups. This compound typically exhibits properties associated with both hydrazides and sulfonamides, including potential biological activity. It is often used in pharmaceutical research due to its ability to interact with various biological targets. The presence of the 4-methylphenyl group suggests that it may possess lipophilic characteristics, which can influence its solubility and permeability in biological systems. Additionally, the benzoic acid moiety contributes to its acidity and potential reactivity. The compound may also exhibit specific structural features that allow for hydrogen bonding and other intermolecular interactions, which are crucial for its biological efficacy. Overall, 4-[[(4-Methylphenyl)amino]sulfonyl]benzoic acid hydrazide is of interest in medicinal chemistry and may serve as a lead compound for further drug development.
Formula:C14H15N3O3S
InChI:InChI=1S/C14H15N3O3S/c1-10-2-6-12(7-3-10)17-21(19,20)13-8-4-11(5-9-13)14(18)16-15/h2-9,17H,15H2,1H3,(H,16,18)
InChI key:InChIKey=XZYKNXDOYUTVRR-UHFFFAOYSA-N
SMILES:S(NC1=CC=C(C)C=C1)(=O)(=O)C2=CC=C(C(NN)=O)C=C2
Synonyms:
  • Benzoic acid, 4-[[(4-methylphenyl)amino]sulfonyl]-, hydrazide
  • 4-[[(4-Methylphenyl)amino]sulfonyl]benzoic acid hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.