CAS 89114-75-0

N,N-Bis(4-methylphenyl)-4-(2-phenylethenyl)benzenamine

Description:

N,N-Bis(4-methylphenyl)-4-(2-phenylethenyl)benzenamine, identified by its CAS number 89114-75-0, is an organic compound characterized by its complex molecular structure, which includes multiple aromatic rings and amine functional groups. This compound features two 4-methylphenyl groups and a phenylethenyl substituent attached to a central benzene ring, contributing to its potential applications in organic electronics and materials science. The presence of the amine group suggests it may exhibit basic properties and participate in various chemical reactions, such as nucleophilic substitutions. Additionally, the compound's aromatic nature may impart stability and influence its solubility in organic solvents. Its unique structure may also lead to interesting photophysical properties, making it a candidate for use in dyes or light-emitting materials. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for comprehensive characterization.

Formula: C₂₈H₂₅N

InChI: InChI=1S/C28H25N/c1-22-8-16-26(17-9-22)29(27-18-10-23(2)11-19-27)28-20-14-25(15-21-28)13-12-24-6-4-3-5-7-24/h3-21H,1-2H3

InChI key: InChIKey=RMTFQLKKBBWGAH-UHFFFAOYSA-N

SMILES: N(C1=CC=C(C=CC2=CC=CC=C2)C=C1)(C3=CC=C(C)C=C3)C4=CC=C(C)C=C4

Synonyms:

• Benzenamine, N,N-bis(4-methylphenyl)-4-(2-phenylethenyl)-
• N,N-Bis(4-methylphenyl)-4-(2-phenylethenyl)benzenamine

Benzenamine, N,N-bis(4-methylphenyl)-4-(2-phenylethenyl)-

CAS: 89114-75-0

Formula: C₂₈H₂₅N

Molecular weight: 375.5048

Ref: IN-DA003ZIR