CymitQuimica logo

CAS 89114-90-9

:

4-(2,2-Diphenylethenyl)-N,N-diphenylbenzenamine

Description:
4-(2,2-Diphenylethenyl)-N,N-diphenylbenzenamine, also known by its CAS number 89114-90-9, is an organic compound characterized by its complex structure, which includes multiple aromatic rings. This substance features a diphenylamine moiety, contributing to its potential applications in organic electronics, particularly in light-emitting diodes (LEDs) and organic photovoltaics. The presence of the 2,2-diphenylethenyl group enhances its photophysical properties, making it suitable for use as a hole transport material. The compound is typically solid at room temperature and exhibits good thermal stability, which is advantageous for various applications. Its molecular structure allows for strong π-π stacking interactions, which can influence its electronic properties. Additionally, the compound may exhibit fluorescence, making it useful in optoelectronic devices. Safety data should be consulted for handling and exposure, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound is of interest in the field of materials science and organic chemistry due to its unique properties and potential applications.
Formula:C32H25N
InChI:InChI=1S/C32H25N/c1-5-13-27(14-6-1)32(28-15-7-2-8-16-28)25-26-21-23-31(24-22-26)33(29-17-9-3-10-18-29)30-19-11-4-12-20-30/h1-25H
InChI key:InChIKey=NIZIGUQDQIALBQ-UHFFFAOYSA-N
SMILES:N(C1=CC=C(C=C(C2=CC=CC=C2)C3=CC=CC=C3)C=C1)(C4=CC=CC=C4)C5=CC=CC=C5
Synonyms:
  • 1,1-Diphenyl-2-[4′-diphenylaminophenyl]ethylene
  • 4-(2,2-Diphenylethenyl)-N,N-diphenylbenzenamine
  • 4-(2,2-diphenylethenyl)-N,N-diphenylaniline
  • Benzenamine, 4-(2,2-diphenylethenyl)-N,N-diphenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.