CAS 89115-87-7

1-(1-Methylethyl)-9(10H)-anthracenone

Description:

1-(1-Methylethyl)-9(10H)-anthracenone, also known as 9(10H)-anthracenone, 1-(1-methylethyl)-, is an organic compound characterized by its anthracene backbone, which is a polycyclic aromatic hydrocarbon. This compound features a ketone functional group at the 9-position of the anthracene ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the isopropyl group (1-methylethyl) enhances its hydrophobic characteristics and may influence its solubility in organic solvents. Typically, compounds like this exhibit fluorescence properties, making them of interest in materials science and photonics. The molecular structure allows for various interactions, including π-π stacking and potential hydrogen bonding, which can affect its physical properties such as melting point and boiling point. Additionally, due to its aromatic nature, it may participate in electrophilic substitution reactions. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken during use.

Formula: C₁₇H₁₆O

InChI: InChI=1S/C17H16O/c1-11(2)14-9-5-7-13-10-12-6-3-4-8-15(12)17(18)16(13)14/h3-9,11H,10H2,1-2H3

InChI key: InChIKey=KOUKUYFJYCWDHK-UHFFFAOYSA-N

SMILES: O=C1C=2C(CC=3C1=CC=CC3)=CC=CC2C(C)C

Synonyms:

• 1-(1-Methylethyl)-9(10H)-anthracenone
• 9(10H)-Anthracenone, 1-(1-methylethyl)-
• 1-Isopropylanthrone

9(10H)-Anthracenone, 1-(1-methylethyl)-

CAS: 89115-87-7

Formula: C₁₇H₁₆O

Molecular weight: 236.3083

Ref: IN-DA003YBK