CAS 891192-95-3
:(S)-3-Boc-2-Thiazolidinecarboxylic acid
Description:
(S)-3-Boc-2-Thiazolidinecarboxylic acid is a chiral compound characterized by its thiazolidine ring structure, which incorporates a thiazole moiety and a carboxylic acid functional group. The "Boc" (tert-butyloxycarbonyl) group serves as a protecting group for the amine, enhancing the compound's stability and facilitating its use in various synthetic applications. This compound is typically utilized in the synthesis of peptides and other bioactive molecules due to its ability to serve as a building block in organic chemistry. The presence of the thiazolidine ring contributes to its unique stereochemistry, which can influence the biological activity and interaction of the compound with biological targets. Additionally, (S)-3-Boc-2-Thiazolidinecarboxylic acid is soluble in organic solvents, making it suitable for various chemical reactions. Its specific stereochemistry and functional groups make it a valuable intermediate in medicinal chemistry and drug development, particularly in the design of compounds with potential therapeutic applications.
Formula:C9H15NO4S
InChI:InChI=1/C9H15NO4S/c1-9(2,3)14-8(13)10-4-5-15-6(10)7(11)12/h6H,4-5H2,1-3H3,(H,11,12)/t6-/m0/s1
SMILES:CC(C)(C)OC(=O)N1CCS[C@H]1C(=O)O
Synonyms:- (S)-3-(tert-Butoxycarbonyl)thiazolidine-2-carboxylic acid
- (2S)-3-(tert-butoxycarbonyl)-1,3-thiazolidine-2-carboxylic acid
- 2,3-Thiazolidinedicarboxylic Acid, 3-(1,1-Dimethylethyl) Ester, (2S)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(S)-3-Boc-thiazolidine-2-carboxylic acid, 97%
CAS:(S)-3-Boc-thiazolidine-2-carboxylic acid is used as an organic chemical synthesis intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar prodFormula:C9H15NO4SPurity:97%Molecular weight:233.282,3-Thiazolidinedicarboxylic acid, 3-(1,1-dimethylethyl) ester, (2S)-
CAS:Formula:C9H15NO4SPurity:95%Color and Shape:SolidMolecular weight:233.2847N-Boc-(S)-thiazolidine-2-carboxylic acid
CAS:N-Boc-(S)-thiazolidine-2-carboxylic acid
Purity:≥95%Molecular weight:233.28g/mol(S)-3-(tert-Butoxycarbonyl)thiazolidine-2-carboxylic acid
CAS:Formula:C9H15NO4SPurity:95%Molecular weight:233.28



