CAS 891197-83-4

2,5-Bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-1,4-benzenedimethanol

Description:

2,5-Bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-1,4-benzenedimethanol, with CAS number 891197-83-4, is a complex organic compound characterized by its multi-ether structure and hydroxyl groups. This substance features a benzene ring substituted with two hydroxymethyl groups and multiple ether linkages, which contribute to its solubility in polar solvents and potential applications in various fields, including pharmaceuticals and materials science. The presence of methoxyethoxy groups enhances its hydrophilicity, making it suitable for use in formulations requiring good water solubility. Additionally, the compound's structure suggests potential for hydrogen bonding, which may influence its physical properties, such as melting point and viscosity. Its unique architecture may also impart specific functionalities, making it a candidate for use as a surfactant or in drug delivery systems. However, detailed studies on its reactivity, stability, and biological interactions would be necessary to fully understand its potential applications and safety profile.

Formula: C₂₂H₃₈O₁₀

InChI: InChI=1S/C22H38O10/c1-25-3-5-27-7-9-29-11-13-31-21-15-20(18-24)22(16-19(21)17-23)32-14-12-30-10-8-28-6-4-26-2/h15-16,23-24H,3-14,17-18H2,1-2H3

InChI key: InChIKey=FCSPNRRABLSUDV-UHFFFAOYSA-N

SMILES: O(CCOCCOCCOC)C1=C(CO)C=C(OCCOCCOCCOC)C(CO)=C1

Synonyms:

• 2,5-Bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-1,4-benzenedimethanol
• 1,4-Benzenedimethanol, 2,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-

1,4-Benzenedimethanol, 2,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-

CAS: 891197-83-4

Formula: C₂₂H₃₈O₁₀

Molecular weight: 462.5311

Ref: IN-DA01PK3U