
CAS 89122-73-6
:3-Piperidinyl acetate
Description:
3-Piperidinyl acetate, with the CAS number 89122-73-6, is an organic compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features an acetate functional group attached to the nitrogen atom of the piperidine ring, influencing its chemical reactivity and solubility. Typically, 3-piperidinyl acetate is a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. It is soluble in polar solvents such as water and alcohols, which enhances its utility in various chemical applications. The compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its properties, such as boiling point, melting point, and specific reactivity, can vary based on the purity and environmental conditions. As with many nitrogen-containing compounds, it may participate in hydrogen bonding, affecting its interactions with other molecules. Safety data should be consulted for handling and storage, as it may pose health risks if not managed properly.
Formula:C7H13NO2
InChI:InChI=1S/C7H13NO2/c1-6(9)10-7-3-2-4-8-5-7/h7-8H,2-5H2,1H3
InChI key:InChIKey=XEANSFYKBWJPTR-UHFFFAOYSA-N
SMILES:O(C(C)=O)C1CCCNC1
Synonyms:- 3-Piperidinol, acetate (ester)
- Acetic acid, 3-piperidinyl ester
- 3-Piperidinyl acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.