CAS 89129-66-8

Methyl 4,4-difluoro-3-oxobutanoate

Description:

Methyl 4,4-difluoro-3-oxobutanoate is an organic compound characterized by its ester functional group and the presence of two fluorine atoms attached to the butanoate backbone. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of fluorine atoms typically enhances the lipophilicity and metabolic stability of the molecule, making it of interest in medicinal chemistry and agrochemical applications. Methyl 4,4-difluoro-3-oxobutanoate is likely to exhibit polar characteristics due to the electronegative fluorine atoms, influencing its solubility in various solvents. Additionally, the compound may participate in nucleophilic addition reactions due to the electrophilic nature of the carbonyl group. Its structural features suggest potential utility in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as fluorinated compounds can exhibit unique toxicological profiles.

Formula: C₅H₆F₂O₃

InChI: InChI=1/C5H6F2O3/c1-10-4(9)2-3(8)5(6)7/h5H,2H2,1H3

SMILES: COC(=O)CC(=O)C(F)F

Synonyms:

• Butanoic Acid, 4,4-Difluoro-3-Oxo-, Methyl Ester

Methyl 4,4-Difluoro-3-oxobutanoate

Controlled Product

CAS: 89129-66-8

Formula: C₅H₆F₂O₃

Color and Shape: Neat

Molecular weight: 152.096

Ref: TR-M102820