CymitQuimica logo

CAS 89129-70-4

:

Heptanoic acid, 4,4,5,5,6,6,7,7,7-nonafluoro-3-oxo-, methyl ester

Description:
Heptanoic acid, 4,4,5,5,6,6,7,7,7-nonafluoro-3-oxo-, methyl ester, with CAS number 89129-70-4, is a fluorinated fatty acid derivative characterized by its unique structure that includes a heptanoic acid backbone and multiple fluorine atoms. This compound typically exhibits properties associated with both fatty acids and fluorinated compounds, such as increased hydrophobicity and thermal stability. The presence of the nonafluoro substituents enhances its chemical resistance and may impart unique biological activity. As a methyl ester, it is likely to be more soluble in organic solvents compared to its acid form. The compound may find applications in various fields, including pharmaceuticals, agrochemicals, and materials science, due to its potential for modifying surface properties and enhancing performance in specific applications. Additionally, the fluorinated nature of the compound can influence its interaction with biological systems, making it of interest for research in medicinal chemistry and environmental science.
Formula:C8H5F9O3
InChI:InChI=1S/C8H5F9O3/c1-20-4(19)2-3(18)5(9,10)6(11,12)7(13,14)8(15,16)17/h2H2,1H3
InChI key:InChIKey=DYOGLAIQTPPUBH-UHFFFAOYSA-N
SMILES:C(C(C(CC(OC)=O)=O)(F)F)(C(C(F)(F)F)(F)F)(F)F
Synonyms:
  • Heptanoic acid, 4,4,5,5,6,6,7,7,7-nonafluoro-3-oxo-, methyl ester
  • Methyl 4,4,5,5,6,6,7,7,7-nonafluoro-3-oxoheptanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.