CAS 89136-90-3
:6-methylheptyl 3-mercaptopropionate
Description:
6-Methylheptyl 3-mercaptopropionate is an organic compound characterized by its structure, which includes a mercapto group (-SH) and an ester functional group. This compound features a heptyl chain with a methyl branch at the sixth carbon position, contributing to its hydrophobic characteristics. The presence of the mercapto group imparts thiol properties, making it reactive and capable of forming disulfide bonds under oxidative conditions. It is typically a colorless to pale yellow liquid with a distinctive odor, often associated with sulfur-containing compounds. The compound is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. Its applications may include use in the synthesis of various chemical intermediates, flavoring agents, or fragrances, owing to its unique structural features. Safety considerations should be taken into account, as thiols can be malodorous and potentially irritating. Proper handling and storage conditions are essential to maintain stability and prevent degradation.
Formula:C11H22O2S
InChI:InChI=1/C11H22O2S/c1-10(2)6-4-3-5-8-13-11(12)7-9-14/h10,14H,3-9H2,1-2H3
InChI key:InChIKey=ZHUWXKIPGGZNJW-UHFFFAOYSA-N
SMILES:CC(C)CCCCCOC(=O)CCS
Synonyms:- 6-Methylheptyl 3-mercaptopropionate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.