CAS 89139-54-8
:atriopeptin ii rat
Description:
Atriopeptin II, also known as atrial natriuretic peptide (ANP) in rats, is a peptide hormone primarily produced in the atria of the heart. It plays a crucial role in regulating blood pressure and fluid balance. The substance is characterized by its ability to induce natriuresis, which is the excretion of sodium through urine, and to promote vasodilation, leading to a decrease in blood volume and pressure. Atriopeptin II acts by binding to specific receptors on target cells, triggering intracellular signaling pathways that result in physiological effects such as increased renal blood flow and inhibition of renin release. The peptide is composed of a chain of amino acids, and its structure is essential for its biological activity. In research, it is often studied for its potential therapeutic implications in cardiovascular diseases and conditions associated with fluid overload. The CAS number 89139-54-8 uniquely identifies this compound, facilitating its recognition in scientific literature and databases.
Formula:C98H156N34O32S2
InChI:InChI=1/C98H156N34O32S2/c1-8-48(5)76-93(161)115-38-71(140)116-50(7)78(146)120-56(26-27-68(100)137)83(151)128-63(42-134)82(150)114-39-73(142)118-58(31-47(3)4)80(148)113-40-74(143)119-66(91(159)125-61(34-69(101)138)87(155)129-65(44-136)89(157)124-60(33-52-21-14-11-15-22-52)86(154)122-57(95(163)164)25-18-30-110-98(106)107)45-165-166-46-67(130-90(158)64(43-135)127-79(147)53(99)41-133)92(160)123-59(32-51-19-12-10-13-20-51)81(149)112-36-70(139)111-37-72(141)117-54(23-16-28-108-96(102)103)84(152)132-77(49(6)9-2)94(162)126-62(35-75(144)145)88(156)121-55(85(153)131-76)24-17-29-109-97(104)105/h10-15,19-22,47-50,53-67,76-77,133-136H,8-9,16-18,23-46,99H2,1-7H3,(H2,100,137)(H2,101,138)(H,111,139)(H,112,149)(H,113,148)(H,114,150)(H,115,161)(H,116,140)(H,117,141)(H,118,142)(H,119,143)(H,120,146)(H,121,156)(H,122,154)(H,123,160)(H,124,157)(H,125,159)(H,126,162)(H,127,147)(H,128,151)(H,129,155)(H,130,158)(H,131,153)(H,132,152)(H,144,145)(H,163,164)(H4,102,103,108)(H4,104,105,109)(H4,106,107,110)/t48-,49-,50-,53-,54-,55-,56-,57-,58-,59-,60-,61-,62-,63-,64-,65-,66-,67-,76-,77-/m0/s1
SMILES:CC[C@H](C)[C@H]1C(=NCC(=N[C@@H](C)C(=N[C@@H](CCC(=N)O)C(=N[C@@H](CO)C(=NCC(=N[C@@H](CC(C)C)C(=NCC(=N[C@@H](CSSC[C@@H](C(=N[C@@H](Cc2ccccc2)C(=NCC(=NCC(=N[C@@H](CCCNC(=N)N)C(=N[C@@H]([C@@H](C)CC)C(=N[C@@H](CC(=O)O)C(=N[C@@H](CCCNC(=N)N)C(=N1)O)O)O)O)O)O)O)O)N=C([C@H](CO)N=C([C@H](CO)N)O)O)C(=N[C@@H](CC(=N)O)C(=N[C@@H](CO)C(=N[C@@H](Cc1ccccc1)C(=N[C@@H](CCCNC(=N)N)C(=O)O)O)O)O)O)O)O)O)O)O)O)O)O
Synonyms:- H-Ser-Ser-Cys-Phe-Gly-Gly-Arg-Ile-Asp-Arg-Ile-Gly-Ala-Gln-Ser-Gly-Leu-Gly-Cys-Asn-Ser-Phe-Arg-OH (Disulfide bond)
- Atriopeptin II, Rat
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.