CAS 89139-72-0

4-(4-Aminobutyl)-3-ethyl-3-methyl-2,5-pyrrolidinedione

Description:

4-(4-Aminobutyl)-3-ethyl-3-methyl-2,5-pyrrolidinedione, also known by its CAS number 89139-72-0, is a chemical compound characterized by its unique pyrrolidine structure, which features a five-membered ring containing nitrogen atoms. This compound typically exhibits properties associated with amines and diketones, including potential basicity due to the presence of the amino group. Its molecular structure suggests it may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions, owing to the reactivity of the carbonyl groups. The presence of both ethyl and methyl substituents contributes to its steric properties, potentially influencing its solubility and reactivity in organic solvents. Additionally, the compound may have biological significance, as similar structures are often investigated for their pharmacological properties. However, specific applications or biological activities would require further research to elucidate its potential uses in medicinal chemistry or other fields. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₁H₂₀N₂O₂

InChI: InChI=1S/C11H20N2O2/c1-3-11(2)8(6-4-5-7-12)9(14)13-10(11)15/h8H,3-7,12H2,1-2H3,(H,13,14,15)

InChI key: InChIKey=BUEOLOVTGALPET-UHFFFAOYSA-N

SMILES: C(CCCN)C1C(CC)(C)C(=O)NC1=O

Synonyms:

• 4-(4-Aminobutyl)-3-ethyl-3-methyl-2,5-pyrrolidinedione
• 2-(4-Aminobutyl)-3-ethyl-3-methylsuccinimide
• 2,5-Pyrrolidinedione, 4-(4-aminobutyl)-3-ethyl-3-methyl-

2,5-Pyrrolidinedione, 4-(4-aminobutyl)-3-ethyl-3-methyl-

CAS: 89139-72-0

Formula: C₁₁H₂₀N₂O₂

Molecular weight: 212.2887

Ref: IN-DA003WXF