CAS 89141-50-4

bis(2-aminoethyl) {4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]phenyl}arsonodithioite dihydrochloride

Description:

Bis(2-aminoethyl) {4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]phenyl}arsonodithioite dihydrochloride, with the CAS number 89141-50-4, is a complex organic compound that features a unique combination of functional groups, including amino, arsonodithioite, and triazine moieties. This compound is characterized by its potential applications in various fields, including medicinal chemistry and materials science, due to its ability to form coordination complexes and its biological activity. The presence of multiple amino groups suggests that it may engage in hydrogen bonding and other interactions, enhancing its solubility and reactivity. As a dihydrochloride salt, it is likely to be more soluble in water, which can facilitate its use in biological systems or as a reagent in chemical reactions. The structural complexity of this compound may also contribute to its unique properties, making it a subject of interest for further research in drug development and chemical synthesis. Safety and handling precautions should be observed due to the presence of arsenic in its structure.

Formula: C₁₃H₂₃AsCl₂N₈S₂

InChI: InChI=1/C13H21AsN8S2.2ClH/c15-5-7-23-14(24-8-6-16)9-1-3-10(4-2-9)19-13-21-11(17)20-12(18)22-13;;/h1-4H,5-8,15-16H2,(H5,17,18,19,20,21,22);2*1H

SMILES: c1cc(ccc1[As](SCCN)SCCN)Nc1nc(=N)[nH]c(=N)[nH]1.Cl.Cl

Melarsomine dihydrochloride

CAS: 89141-50-4

Melarsomine dihydrochloride, used to treat canine heartworm and other helminths, is also a research tool.

Formula: C₁₃H₂₃AsCl₂N₈S₂

Color and Shape: Solid

Molecular weight: 501.33

Ref: TM-T41020

Melarsomine Dihydrochloride

CAS: 89141-50-4

Formula: C₁₃H₂₁AsN₈S₂·2ClH

Color and Shape: Neat

Molecular weight: 501.33

Ref: TR-M215105

Melarsomine dihydrochloride

CAS: 89141-50-4

Please enquire for more information about Melarsomine dihydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₃H₂₁AsN₈S₂•(HCl)₂

Purity: Min. 95%

Molecular weight: 501.34 g/mol

Ref: 3D-FM184080