CAS 89141-65-1

1,3-Dihydro-1,3-dimethyl-7-nitro-5-phenyl-2H-1,4-benzodiazepin-2-one

Description:

1,3-Dihydro-1,3-dimethyl-7-nitro-5-phenyl-2H-1,4-benzodiazepin-2-one, with the CAS number 89141-65-1, is a synthetic compound belonging to the benzodiazepine class of chemicals. This substance features a benzodiazepine core structure, characterized by a fused benzene and diazepine ring, which contributes to its pharmacological properties. The presence of a nitro group at the 7-position and a phenyl group at the 5-position enhances its chemical reactivity and potential biological activity. Typically, compounds in this class exhibit anxiolytic, sedative, and muscle relaxant effects, although specific biological activities can vary based on structural modifications. The compound is likely to be lipophilic, allowing it to cross biological membranes easily, which is a common trait among benzodiazepines. Its solubility, stability, and reactivity can be influenced by the presence of functional groups such as the nitro and methyl groups. As with many benzodiazepines, safety and efficacy in therapeutic applications would require thorough investigation through pharmacological studies.

Formula: C₁₇H₁₅N₃O₃

InChI: InChI=1S/C17H15N3O3/c1-11-17(21)19(2)15-9-8-13(20(22)23)10-14(15)16(18-11)12-6-4-3-5-7-12/h3-11H,1-2H3

InChI key: InChIKey=ASEJDTDWRXVAHE-UHFFFAOYSA-N

SMILES: CN1C=2C(C(=NC(C)C1=O)C3=CC=CC=C3)=CC(N(=O)=O)=CC2

Synonyms:

• 1,3-Dihydro-1,3-dimethyl-7-nitro-5-phenyl-2H-1,4-benzodiazepin-2-one
• 2H-1,4-Benzodiazepin-2-one, 1,3-dihydro-1,3-dimethyl-7-nitro-5-phenyl-

3-Methyl Mimetazepam

Controlled Product

CAS: 89141-65-1

Formula: C₁₇H₁₅N₃O₃

Color and Shape: Neat

Molecular weight: 309.32

Ref: TR-M282650