
CAS 89141-65-1
:1,3-Dihydro-1,3-dimethyl-7-nitro-5-phenyl-2H-1,4-benzodiazepin-2-one
Description:
1,3-Dihydro-1,3-dimethyl-7-nitro-5-phenyl-2H-1,4-benzodiazepin-2-one, with the CAS number 89141-65-1, is a synthetic compound belonging to the benzodiazepine class of chemicals. This substance features a benzodiazepine core structure, characterized by a fused benzene and diazepine ring, which contributes to its pharmacological properties. The presence of a nitro group at the 7-position and a phenyl group at the 5-position enhances its chemical reactivity and potential biological activity. Typically, compounds in this class exhibit anxiolytic, sedative, and muscle relaxant effects, although specific biological activities can vary based on structural modifications. The compound is likely to be lipophilic, allowing it to cross biological membranes easily, which is a common trait among benzodiazepines. Its solubility, stability, and reactivity can be influenced by the presence of functional groups such as the nitro and methyl groups. As with many benzodiazepines, safety and efficacy in therapeutic applications would require thorough investigation through pharmacological studies.
Formula:C17H15N3O3
InChI:InChI=1S/C17H15N3O3/c1-11-17(21)19(2)15-9-8-13(20(22)23)10-14(15)16(18-11)12-6-4-3-5-7-12/h3-11H,1-2H3
InChI key:InChIKey=ASEJDTDWRXVAHE-UHFFFAOYSA-N
SMILES:CN1C=2C(C(=NC(C)C1=O)C3=CC=CC=C3)=CC(N(=O)=O)=CC2
Synonyms:- 1,3-Dihydro-1,3-dimethyl-7-nitro-5-phenyl-2H-1,4-benzodiazepin-2-one
- 2H-1,4-Benzodiazepin-2-one, 1,3-dihydro-1,3-dimethyl-7-nitro-5-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Methyl Mimetazepam
CAS:Controlled ProductFormula:C17H15N3O3Color and Shape:NeatMolecular weight:309.32
