
CAS 89143-08-8
:1-(4-Butoxyphenyl)-1H-pyrrole-2,5-dione
Description:
1-(4-Butoxyphenyl)-1H-pyrrole-2,5-dione, with the CAS number 89143-08-8, is an organic compound characterized by its unique structure, which includes a pyrrole ring substituted with a butoxyphenyl group. This compound typically exhibits properties associated with both the pyrrole and phenolic functionalities, such as potential reactivity in electrophilic substitution reactions and the ability to participate in hydrogen bonding due to the presence of the carbonyl groups in the pyrrole ring. It may display moderate solubility in organic solvents, influenced by the butoxy substituent, which enhances its hydrophobic character. The compound's structure suggests potential applications in organic synthesis, materials science, or as a precursor in the development of dyes or pharmaceuticals. Additionally, its stability and reactivity can vary based on environmental conditions, such as pH and temperature. As with many organic compounds, safety precautions should be taken when handling this substance, including the use of appropriate personal protective equipment and adherence to safety data sheet guidelines.
Formula:C14H15NO3
InChI:InChI=1S/C14H15NO3/c1-2-3-10-18-12-6-4-11(5-7-12)15-13(16)8-9-14(15)17/h4-9H,2-3,10H2,1H3
InChI key:InChIKey=QPSIVQYERUUXJE-UHFFFAOYSA-N
SMILES:O=C1N(C(=O)C=C1)C2=CC=C(OCCCC)C=C2
Synonyms:- 1-(4-Butoxy-phenyl)-pyrrole-2,5-dione
- N-(p-Butoxyphenyl)maleimide
- 1H-Pyrrole-2,5-dione, 1-(4-butoxyphenyl)-
- 1-(4-Butoxyphenyl)-1H-pyrrole-2,5-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
