CAS 89143-18-0

1′-(4-Butoxyphenyl)[1,3′-bipyrrolidine]-2′,5′-dione

Description:

1′-(4-Butoxyphenyl)[1,3′-bipyrrolidine]-2′,5′-dione, identified by its CAS number 89143-18-0, is a chemical compound that features a bipyrrolidine core substituted with a butoxyphenyl group and two carbonyl (dione) functionalities. This compound is characterized by its unique structural arrangement, which includes a bipyrrolidine framework that contributes to its potential biological activity. The presence of the butoxy group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. The dione functional groups may participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties can be further explored through spectroscopic methods such as NMR and mass spectrometry. Overall, 1′-(4-Butoxyphenyl)[1,3′-bipyrrolidine]-2′,5′-dione represents a versatile structure with potential applications in various fields of research.

Formula: C₁₈H₂₄N₂O₃

InChI: InChI=1S/C18H24N2O3/c1-2-3-12-23-15-8-6-14(7-9-15)20-17(21)13-16(18(20)22)19-10-4-5-11-19/h6-9,16H,2-5,10-13H2,1H3

InChI key: InChIKey=MXOLJNDOBFYWDF-UHFFFAOYSA-N

SMILES: O=C1N(C(=O)CC1N2CCCC2)C3=CC=C(OCCCC)C=C3

Synonyms:

• [1,3′-Bipyrrolidine]-2′,5′-dione, 1′-(4-butoxyphenyl)-
• 1′-(4-Butoxyphenyl)[1,3′-bipyrrolidine]-2′,5′-dione

[1,3'-Bipyrrolidine]-2',5'-dione, 1'-(4-butoxyphenyl)-

CAS: 89143-18-0

Formula: C₁₈H₂₄N₂O₃

Molecular weight: 316.3948

Ref: IN-DA003YXL