CAS 891494-66-9

1,1-Dimethylethyl 3-(7-hydroxypyrazolo[1,5-a]pyrimidin-5-yl)-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 3-(7-hydroxypyrazolo[1,5-a]pyrimidin-5-yl)-1-piperidinecarboxylate, identified by its CAS number 891494-66-9, is a chemical compound that features a complex structure incorporating a piperidine ring and a pyrazolopyrimidine moiety. This compound is characterized by the presence of a tert-butyl group (1,1-dimethylethyl) which contributes to its steric bulk and may influence its biological activity and solubility. The hydroxyl group on the pyrazolo[1,5-a]pyrimidine structure suggests potential for hydrogen bonding, which can enhance interactions with biological targets. The carboxylate functional group indicates that this compound may exhibit acidic properties, potentially affecting its reactivity and solubility in various solvents. Overall, the unique combination of functional groups and structural features suggests that this compound may have specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Further studies would be necessary to elucidate its biological activity and potential applications.

Formula: C₁₆H₂₂N₄O₃

InChI: InChI=1S/C16H22N4O3/c1-16(2,3)23-15(22)19-8-4-5-11(10-19)12-9-14(21)20-13(18-12)6-7-17-20/h6-7,9,11,21H,4-5,8,10H2,1-3H3

InChI key: InChIKey=SOWNZMVKUDOWGC-UHFFFAOYSA-N

SMILES: OC=1N2C(N=C(C1)C3CN(C(OC(C)(C)C)=O)CCC3)=CC=N2

Synonyms:

• 1,1-Dimethylethyl 3-(7-hydroxypyrazolo[1,5-a]pyrimidin-5-yl)-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 3-(7-hydroxypyrazolo[1,5-a]pyrimidin-5-yl)-, 1,1-dimethylethyl ester