CAS 891503-79-0

1,2,3-Trimethyl-1-(2-propen-1-yl)-1H-benz[e]indolium bromide

Description:

1,2,3-Trimethyl-1-(2-propen-1-yl)-1H-benz[e]indolium bromide is a synthetic organic compound characterized by its complex structure, which includes a benz[e]indole core substituted with multiple methyl groups and a propenyl group. This compound typically exhibits a bright color due to its conjugated system, which can also contribute to its potential applications in dyes or pigments. The presence of the bromide ion suggests that it may have ionic properties, influencing its solubility in various solvents. Additionally, the compound may display interesting photophysical properties, making it suitable for use in organic electronics or as a fluorescent probe. Its synthesis involves multi-step organic reactions, and it may be of interest in research fields such as materials science or medicinal chemistry. As with many organic compounds, safety precautions should be taken when handling it, as it may pose risks such as toxicity or environmental hazards.

Formula: C₁₈H₂₀BrN

InChI: InChI=1/C18H20N.BrH/c1-5-12-18(3)13(2)19(4)16-11-10-14-8-6-7-9-15(14)17(16)18;/h5-11H,1,12H2,2-4H3;1H/q+1;/p-1

Synonyms:

• 1,2,3-Trimethyl-1-(2-propen-1-yl)-1H-benz[e]indolium bromide
• 1,2,3-Trimethyl-1-(2-propen-1-yl)-1H-benzo[e]indolium bromide
• 1H-Benz[e]indoliuM
• 1H-Benz[e]indolium,1,2,3-trimethyl-1-(2-propen-1-yl)-, bromide (1:1)