CAS 89151-44-0

1-Boc-4-(2-hydroxyethyl)piperidine

Description:

1-Boc-4-(2-hydroxyethyl)piperidine is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The "Boc" (tert-butyloxycarbonyl) group serves as a protective group for the amine, enhancing the compound's stability and solubility in organic solvents. The presence of the 2-hydroxyethyl substituent introduces a hydroxyl group, which can participate in hydrogen bonding, potentially influencing the compound's reactivity and solubility in polar solvents. This compound is typically used in organic synthesis, particularly in the preparation of more complex molecules, including pharmaceuticals and biologically active compounds. Its structure allows for various functionalization reactions, making it a versatile intermediate in synthetic chemistry. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and solvents used. Overall, 1-Boc-4-(2-hydroxyethyl)piperidine is a valuable building block in medicinal chemistry and related fields.

Formula: C₁₂H₂₃NO₃

InChI: InChI=1/C12H23NO3/c1-12(2,3)16-11(15)13-7-4-10(5-8-13)6-9-14/h10,14H,4-9H2,1-3H3

SMILES: CC(C)(C)OC(=O)N1CCC(CC1)CCO

Synonyms:

• N-(tert-Butoxycarbonyl)-4-piperidineethanol
• 4-(2-Hydroxyethyl)piperidine-1-carboxylic acid tert-butyl ester
• Tert-Butyl 4-(2-Hydroxyethyl)Piperidine-1-Carboxylate
• N-Boc-4-piperidineethanol
• N-BOC-4-Piperidine ethanol

N-Boc-4-Piperidineethanol

CAS: 89151-44-0

Formula: C₁₂H₂₃NO₃

Purity: 97%

Color and Shape: Liquid

Molecular weight: 229.3159

Ref: IN-DA003E1G

4-(2-Hydroxyethyl)piperidine, N-BOC protected

CAS: 89151-44-0

4-(2-Hydroxyethyl)piperidine, N-BOC protected

Formula: C₁₂H₂₃NO₃

Purity: 97%

Color and Shape: almost colourless. viscous liquid

Molecular weight: 229.32g/mol

Ref: 54-OR1989

N-Boc-4-Piperidineethanol

CAS: 89151-44-0

Formula: C₁₂H₂₃NO₃

Purity: 97%

Color and Shape: Viscous liquid

Molecular weight: 229.32

Ref: 10-F048693