CAS 89151-76-8
:5-(1,3-Dithian-2-yl)-1,3,4-thiadiazol-2-amine
Description:
5-(1,3-Dithian-2-yl)-1,3,4-thiadiazol-2-amine is a heterocyclic compound characterized by the presence of both a thiadiazole ring and a dithiane moiety. The thiadiazole ring contributes to its potential biological activity, often associated with antimicrobial and antifungal properties. The compound features a nitrogen atom in the thiadiazole structure, which can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. The dithiane group enhances the compound's stability and solubility in organic solvents, which is beneficial for various applications in medicinal chemistry. Additionally, the presence of sulfur atoms in both the thiadiazole and dithiane structures may impart unique electronic properties, influencing the compound's reactivity and interaction with biological targets. Overall, this compound's unique structural features suggest potential utility in pharmaceutical development and materials science, although specific applications would depend on further research and characterization.
Formula:C6H9N3S3
InChI:InChI=1S/C6H9N3S3/c7-6-9-8-4(12-6)5-10-2-1-3-11-5/h5H,1-3H2,(H2,7,9)
InChI key:InChIKey=SBDWAJDZSLLLFT-UHFFFAOYSA-N
SMILES:NC=1SC(=NN1)C2SCCCS2
Synonyms:- 5-(1,3-Dithian-2-yl)-1,3,4-thiadiazol-2-amine
- 1,3,4-Thiadiazol-2-amine, 5-(1,3-dithian-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
