CymitQuimica logo

CAS 89152-86-3

:

2-(4-Methylphenyl)-4-thiazolemethanamine

Description:
2-(4-Methylphenyl)-4-thiazolemethanamine, identified by its CAS number 89152-86-3, is an organic compound characterized by its thiazole ring and an amine functional group. The thiazole moiety contributes to its potential biological activity, as thiazoles are known for their presence in various pharmaceuticals and agrochemicals. The presence of the 4-methylphenyl group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. This compound may exhibit properties such as antimicrobial or antifungal activity, although specific biological activities would depend on further empirical studies. Its molecular structure suggests it could participate in various chemical reactions typical of amines, such as nucleophilic substitutions. Additionally, the compound's stability, reactivity, and potential applications in medicinal chemistry or material science would be of interest for further research. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C11H12N2S
InChI:InChI=1S/C11H12N2S/c1-8-2-4-9(5-3-8)11-13-10(6-12)7-14-11/h2-5,7H,6,12H2,1H3
InChI key:InChIKey=UFFXWQHDZYKYJH-UHFFFAOYSA-N
SMILES:C(N)C=1N=C(SC1)C2=CC=C(C)C=C2
Synonyms:
  • 2-(4-Methylphenyl)-4-thiazolemethanamine
  • [2-(4-Methylphenyl)-1,3-thiazol-4-yl]methylamine
  • 4-Thiazolemethanamine, 2-(4-methylphenyl)-
  • [2-(4-Methylphenyl)-1,3-thiazol-4-yl]methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.