CymitQuimica logo

CAS 89159-32-0

:

6-Methyl-7-nitro-1H-pyrrolo[3,4-c]pyridine-3,4(2H,5H)-dione

Description:
6-Methyl-7-nitro-1H-pyrrolo[3,4-c]pyridine-3,4(2H,5H)-dione, with the CAS number 89159-32-0, is a heterocyclic organic compound characterized by its complex bicyclic structure that includes both pyrrole and pyridine rings. This compound features a methyl group and a nitro group, which contribute to its chemical reactivity and potential biological activity. The presence of the dione functional groups indicates that it can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Its unique structure may also confer specific pharmacological properties, making it of interest in medicinal chemistry. The compound is typically studied for its potential applications in drug development, particularly in targeting specific biological pathways. As with many heterocycles, it may exhibit interesting electronic properties due to the conjugation within its ring system. Safety and handling precautions should be observed, as with all chemical substances, particularly those with nitro groups, which can be sensitive to heat and shock.
Formula:C8H7N3O4
InChI:InChI=1S/C8H7N3O4/c1-3-6(11(14)15)4-2-9-7(12)5(4)8(13)10-3/h2H2,1H3,(H,9,12)(H,10,13)
InChI key:InChIKey=CLRITWLHQNIIRF-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C2=C(C(=O)NC1C)C(=O)NC2
Synonyms:
  • 6-Methyl-7-nitro-1H-pyrrolo[3,4-c]pyridine-3,4(2H,5H)-dione
  • 1H-Pyrrolo[3,4-c]pyridine-3,4(2H,5H)-dione, 6-methyl-7-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.