CymitQuimica logo

CAS 89159-35-3

:

1H-Pyrrolo[3,4-c]pyridine-3,4(2H,5H)-dione, 6-methyl-, sulfate (2:1)

Description:
1H-Pyrrolo[3,4-c]pyridine-3,4(2H,5H)-dione, 6-methyl-, sulfate (2:1), commonly referred to by its CAS number 89159-35-3, is a chemical compound characterized by its complex bicyclic structure that includes a pyrrole and pyridine moiety. This compound features a methyl group at the 6-position and is associated with a sulfate group in a 2:1 ratio, indicating the presence of two sulfate ions for each molecule of the pyrrolo compound. It typically exhibits properties such as solubility in polar solvents, which is influenced by the sulfate groups. The compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that can interact with biological targets. Its stability, reactivity, and potential biological activity are subjects of interest in research, particularly in the context of drug design and synthesis. Safety data and handling precautions should be observed, as with any chemical substance, to ensure proper laboratory practices.
Formula:C8H8N2O2H2O4S
InChI:InChI=1S/C8H8N2O2.H2O4S/c1-4-2-5-3-9-7(11)6(5)8(12)10-4;1-5(2,3)4/h2H,3H2,1H3,(H,9,11)(H,10,12);(H2,1,2,3,4)
InChI key:InChIKey=NBUHRWLUMCLCIF-UHFFFAOYSA-N
SMILES:O=C1C2=C(C=C(C)N1)CNC2=O.S(=O)(=O)(O)O
Synonyms:
  • 1H-Pyrrolo[3,4-c]pyridine-3,4(2H,5H)-dione, 6-methyl-, sulfate (2:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.