CAS 891638-31-6
:1-[1-(morpholin-4-yl)cycloheptyl]methanamine
Description:
1-[1-(Morpholin-4-yl)cycloheptyl]methanamine, with the CAS number 891638-31-6, is a chemical compound characterized by its unique structure that includes a cycloheptyl ring and a morpholine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of the amine functional group. The morpholine ring contributes to its potential solubility in polar solvents and may influence its biological activity. The presence of the cycloheptyl group can affect the steric and electronic properties of the molecule, potentially impacting its interactions with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could confer specific pharmacological properties. As with many amines, it may also exhibit reactivity typical of amines, such as nucleophilic behavior. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.
Formula:C12H24N2O
InChI:InChI=1/C12H24N2O/c13-11-12(5-3-1-2-4-6-12)14-7-9-15-10-8-14/h1-11,13H2
SMILES:C1CCCC(CC1)(CN)N1CCOCC1
Synonyms:- (1-Morpholin-4-Ylcycloheptyl)Methylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
