CAS 89167-19-1
:pyridine, 3-bromo-4-iodo-
Description:
3-Bromo-4-iodopyridine, with the CAS number 89167-19-1, is a heterocyclic organic compound that belongs to the pyridine family. It features a six-membered aromatic ring containing one nitrogen atom and two halogen substituents: bromine and iodine. This compound is typically characterized by its pale yellow to brownish appearance and has a distinct aromatic odor. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to its non-polar characteristics. The presence of both bromine and iodine atoms makes it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its reactivity is influenced by the electron-withdrawing nature of the halogens, which can facilitate nucleophilic substitution reactions. Additionally, 3-bromo-4-iodopyridine can participate in cross-coupling reactions, making it a useful building block in the synthesis of more complex organic molecules. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks.
Formula:C5H3BrIN
InChI:InChI=1/C5H3BrIN/c6-4-3-8-2-1-5(4)7/h1-3H
SMILES:c1cncc(c1I)Br
Synonyms:- 3-Bromo-4-Iodopyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Bromo-4-iodopyridine
CAS:3-Bromo-4-iodopyridine is a molecule that regulates the positioning of molecules. It has two different isomers, which have different conformational and intramolecular hydrogen bonding properties. 3-Bromo-4-iodopyridine is synthesized by reacting 3-bromopyridine with iodine monochloride in the presence of sodium hydroxide. This reaction produces a mixture of the two isomers, which can be separated using fractional crystallization or chromatography. 3-Bromo-4-iodopyridine has been shown to stabilize low efficiency solar cells.Formula:C5H3BrINPurity:Min. 95%Molecular weight:283.89 g/mol



