CAS 89167-34-0
:4-chloro-3-iodopyridine
Description:
4-Chloro-3-iodopyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with both chlorine and iodine atoms. The presence of these halogen substituents at the 4 and 3 positions, respectively, influences its chemical reactivity and physical properties. This compound typically appears as a colorless to light yellow liquid or solid, depending on its form and purity. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to the hydrophobic nature of the pyridine ring. 4-Chloro-3-iodopyridine is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of halogens can enhance its reactivity, making it a valuable intermediate in the synthesis of more complex molecules. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C5H3ClIN
InChI:InChI=1/C5H3ClIN/c6-4-1-2-8-3-5(4)7/h1-3H
SMILES:c1cncc(c1Cl)I
Synonyms:- Pyridine, 4-Chloro-3-Iodo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Chloro-3-iodopyridine
CAS:4-Chloro-3-iodopyridinePurity:98%Color and Shape:White To Light Brown PowderMolecular weight:239.44148g/mol4-Chloro-3-iodopyridine
CAS:<p>4-Chloro-3-iodopyridine is a heterocyclic compound that has been used in the synthesis of tripeptides. 4-Chloro-3-iodopyridine can be synthesized by the cross-coupling of an unsymmetrical quinoline derivative and an iodide. This reaction is catalyzed by copper and produces a mixture of regioisomers. The isolated yield obtained from this synthesis was low, with only 3% being the desired product. The synthesis of 4-chloro-3-iodopyridine was also shown to have high yields when using anthracene as a starting material and halopyridines as coupling partners.</p>Formula:C5H3ClINPurity:Min. 95%Molecular weight:239.44 g/mol
