CAS 89167-37-3
:Pyridine, 4-chloro-3-nitro-, 1-oxide
Description:
Pyridine, 4-chloro-3-nitro-, 1-oxide, with the CAS number 89167-37-3, is a heterocyclic organic compound characterized by a pyridine ring substituted with a chlorine atom and a nitro group, along with an oxide functional group. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents. The presence of the nitro group contributes to its potential as an electron-withdrawing substituent, influencing its reactivity and polarity. Pyridine derivatives are known for their applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The 1-oxide designation indicates the presence of an oxygen atom bonded to the nitrogen of the pyridine ring, which can affect the compound's basicity and overall chemical behavior. Additionally, the chlorine and nitro substituents can enhance the compound's reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Safety data should be consulted, as compounds with nitro and halogen substituents may pose health and environmental risks.
Formula:C5H3ClN2O3
InChI:InChI=1S/C5H3ClN2O3/c6-4-1-2-7(9)3-5(4)8(10)11/h1-3H
InChI key:InChIKey=IGLDADAPDSPFDD-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C(Cl)=CC=N(=O)C1
Synonyms:- NSC 118084
- Pyridine, 4-chloro-3-nitro-, 1-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
