CAS 89171-32-4
:4,8-Decadienamide, N,N,5,9-tetramethyl-, (E)-
Description:
4,8-Decadienamide, N,N,5,9-tetramethyl-, (E)-, with the CAS number 89171-32-4, is an organic compound characterized by its amide functional group and a long carbon chain. This substance features a conjugated diene system, which contributes to its reactivity and potential applications in organic synthesis. The presence of the N,N-dimethyl substituents indicates that it has two methyl groups attached to the nitrogen atom, enhancing its steric properties and possibly influencing its solubility and boiling point. The (E)- configuration denotes that the substituents on the double bonds are on opposite sides, which can affect the compound's physical properties and reactivity. Generally, compounds like this may exhibit interesting biological activities and could be of interest in fields such as medicinal chemistry or materials science. However, specific safety and handling guidelines should be followed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C14H25NO
InChI:InChI=1S/C14H25NO/c1-12(2)8-6-9-13(3)10-7-11-14(16)15(4)5/h8,10H,6-7,9,11H2,1-5H3/b13-10+
InChI key:InChIKey=JRXASSGEAANSSR-JLHYYAGUSA-N
SMILES:C(CC/C=C(/CCC=C(C)C)\C)(N(C)C)=O
Synonyms:- 4,8-Decadienamide, N,N,5,9-tetramethyl-, (E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
