CymitQuimica logo

CAS 89176-31-8

:

4-Amino-N,N,5-trimethyl-3-pyridinecarboxamide

Description:
4-Amino-N,N,5-trimethyl-3-pyridinecarboxamide, with the CAS number 89176-31-8, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) and a carboxamide group (-C(=O)NH2) attached to the pyridine ring, contributing to its polar nature and potential for hydrogen bonding. The presence of three methyl groups at the N,N,5 positions enhances its lipophilicity and can influence its solubility in organic solvents. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and acylation. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the pyridine ring. Overall, 4-Amino-N,N,5-trimethyl-3-pyridinecarboxamide is a versatile compound with potential applications in medicinal chemistry and related fields.
Formula:C9H13N3O
InChI:InChI=1S/C9H13N3O/c1-6-4-11-5-7(8(6)10)9(13)12(2)3/h4-5H,1-3H3,(H2,10,11)
InChI key:InChIKey=FYKLZAAMIQWBNJ-UHFFFAOYSA-N
SMILES:C(N(C)C)(=O)C=1C(N)=C(C)C=NC1
Synonyms:
  • 4-Amino-N,N,5-trimethyl-3-pyridinecarboxamide
  • 3-Pyridinecarboxamide, 4-amino-N,N,5-trimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.