CymitQuimica logo

CAS 891781-87-6

:

4-({2-[(tert-butoxycarbonyl)amino]ethyl}amino)-4-oxobutanoic acid

Description:
4-({2-[(tert-butoxycarbonyl)amino]ethyl}amino)-4-oxobutanoic acid, with the CAS number 891781-87-6, is a synthetic organic compound characterized by its complex structure, which includes an oxobutanoic acid moiety and a tert-butoxycarbonyl (Boc) protecting group on the amino group. This compound typically exhibits properties associated with amino acids and derivatives, such as solubility in polar solvents and potential reactivity due to the presence of functional groups like the carboxylic acid and amine. The tert-butoxycarbonyl group serves as a protective group, commonly used in peptide synthesis to prevent unwanted reactions during the formation of peptide bonds. The compound may also exhibit biological activity, making it of interest in pharmaceutical research and development. Its stability, reactivity, and solubility can vary based on environmental conditions such as pH and temperature, which are crucial for its application in biochemical contexts. Overall, this compound is significant in the field of medicinal chemistry and peptide synthesis.
Formula:C11H20N2O5
InChI:InChI=1/C11H20N2O5/c1-11(2,3)18-10(17)13-7-6-12-8(14)4-5-9(15)16/h4-7H2,1-3H3,(H,12,14)(H,13,17)(H,15,16)
SMILES:CC(C)(C)OC(=NCCN=C(CCC(=O)O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.