CymitQuimica logo

CAS 891782-61-9

:

2-Piperazinepropanoic acid

Description:
2-Piperazinepropanoic acid is an organic compound characterized by its piperazine and propanoic acid functional groups. It features a piperazine ring, which is a six-membered cyclic amine, contributing to its basicity and potential for forming hydrogen bonds. The propanoic acid moiety provides acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. This compound is typically a white to off-white solid and is soluble in water and polar organic solvents, making it versatile for various applications in pharmaceuticals and biochemistry. Its structure allows for interactions with biological systems, which may lead to potential therapeutic uses. Additionally, the presence of both basic and acidic functional groups can facilitate the formation of salts and derivatives, enhancing its utility in drug formulation and development. Overall, 2-Piperazinepropanoic acid is of interest in medicinal chemistry due to its unique structural features and potential biological activity.
Formula:C7H14N2O2
InChI:InChI=1S/C7H14N2O2/c10-7(11)2-1-6-5-8-3-4-9-6/h6,8-9H,1-5H2,(H,10,11)
InChI key:InChIKey=LQXCKFAKIHBGOZ-UHFFFAOYSA-N
SMILES:C(CC(O)=O)C1CNCCN1
Synonyms:
  • 3-PIPERAZIN-2-YL-PROPIONIC ACID
  • 2-Piperazinepropanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.