CAS 891785-28-7

6-bromoisoquinolin-3-amine

Description:

6-Bromoisoquinolin-3-amine is a chemical compound characterized by its isoquinoline structure, which features a bromine atom at the 6-position and an amino group at the 3-position of the isoquinoline ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including stability and potential reactivity due to the presence of the amino group, which can participate in various chemical reactions such as nucleophilic substitutions. The bromine substituent can also influence the compound's reactivity and solubility. In terms of applications, compounds like 6-bromoisoquinolin-3-amine are often explored in medicinal chemistry for their potential biological activities, including antimicrobial and anticancer properties. The presence of both the bromine and amino groups may enhance the compound's ability to interact with biological targets. Additionally, its molecular structure allows for various synthetic modifications, making it a valuable intermediate in organic synthesis. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₉H₇BrN₂

InChI: InChI=1/C9H7BrN2/c10-8-2-1-6-5-12-9(11)4-7(6)3-8/h1-5H,(H2,11,12)

SMILES: c1cc(cc2cc(N)ncc12)Br

Synonyms:

• 3-Isoquinolinamine, 6-Bromo-

6-Bromoisoquinolin-3-amine

CAS: 891785-28-7

Formula: C₉H₇BrN₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 223.0693

Ref: IN-DA00369E

3-Amino-6-bromoisoquinoline

CAS: 891785-28-7

3-Amino-6-bromoisoquinoline

Formula: C₉H₇BrN₂

Purity: 98%

Color and Shape: light yellow solid

Molecular weight: 223.07g/mol

Ref: 54-OR17655

6-Bromoisoquinolin-3-amine

CAS: 891785-28-7

Purity: 95%

Molecular weight: 223.069

Ref: FT-B11726

3-Amino-6-bromoisoquinoline

CAS: 891785-28-7

Formula: C₉H₇BrN₂

Purity: 96%

Color and Shape: Sand-coloured powder

Molecular weight: 223.073

Ref: 10-F221432

6-Bromoisoquinolin-3-amine

Controlled Product

CAS: 891785-28-7

Formula: C₉H₇BrN₂

Color and Shape: Neat

Molecular weight: 223.069

Ref: TR-B292405