CAS 89179-72-6
:4-methyl-1,3-thiazole-5-carbohydrazide
Description:
4-Methyl-1,3-thiazole-5-carbohydrazide is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a methyl group at the 4-position and a carbohydrazide functional group at the 5-position of the thiazole ring. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydrazide functional group, which can engage in hydrogen bonding. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as antimicrobial or antifungal properties. Its reactivity can be attributed to the presence of the hydrazide moiety, which can participate in condensation reactions and form derivatives. Additionally, the thiazole ring contributes to the compound's stability and electronic properties, making it a valuable scaffold for further chemical modifications. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C5H7N3OS
InChI:InChI=1/C5H7N3OS/c1-3-4(5(9)8-6)10-2-7-3/h2H,6H2,1H3,(H,8,9)
SMILES:Cc1c(C(=NN)O)scn1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4-Methyl-1,3-thiazole-5-carbohydrazide
CAS:4-Methyl-1,3-thiazole-5-carbohydrazide (MTZ) is a crystalline solid that has been shown to be stable in water and other polar solvents. It has been used as a precursor for the synthesis of sulfonyl chloride compounds. MTZ can be prepared by reacting benzenesulfonyl chloride with methyl iodide in the presence of potassium carbonate. This reaction results in an intermolecular S2 substitution on the benzene ring, which is stabilized by hydrogen bonding. MTZ reacts with Cl and Br to form chlorides and bromides respectively.Formula:C5H7N3OSPurity:Min. 95%Molecular weight:157.2 g/mol
