CAS 89180-20-1
:(4,6-diamino-1,3,5-triazin-2-yl)acetic acid
Description:
(4,6-Diamino-1,3,5-triazin-2-yl)acetic acid, with the CAS number 89180-20-1, is an organic compound characterized by its triazine ring structure, which features two amino groups at the 4 and 6 positions and an acetic acid moiety attached at the 2 position. This compound is typically a white to off-white solid and is soluble in water due to the presence of the carboxylic acid functional group. It exhibits properties such as being a potential chelating agent and may participate in various chemical reactions due to the reactivity of its amino and carboxylic acid groups. The presence of multiple amino groups suggests that it could be involved in hydrogen bonding and may have applications in fields such as agriculture, particularly as a herbicide or plant growth regulator. Additionally, its structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry and biochemistry. Overall, (4,6-diamino-1,3,5-triazin-2-yl)acetic acid is a versatile compound with various potential applications.
Formula:C5H7N5O2
InChI:InChI=1/C5H7N5O2/c6-4-8-2(1-3(11)12)9-5(7)10-4/h1H2,(H,11,12)(H4,6,7,8,9,10)
SMILES:C(c1nc(=N)[nH]c(=N)[nH]1)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
