CAS 89180-51-8

2,5-dichloropyrimidin-4-amine

Description:

2,5-Dichloropyrimidin-4-amine is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions. This compound features two chlorine substituents at the 2 and 5 positions and an amino group (-NH2) at the 4 position of the pyrimidine ring. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group. Its chlorinated structure can influence its biological activity, making it a subject of interest in medicinal chemistry for the development of new therapeutic agents. Additionally, the compound's stability and reactivity can be affected by environmental conditions, such as pH and temperature, which are important considerations in its handling and application.

Formula: C₄H₃Cl₂N₃

InChI: InChI=1/C4H3Cl2N3/c5-2-1-8-4(6)9-3(2)7/h1H,(H2,7,8,9)

SMILES: c1c(c(=N)[nH]c(Cl)n1)Cl

Synonyms:

• 4-Pyrimidinamine, 2,5-dichloro-

2,5-Dichloropyrimidin-4-amine

CAS: 89180-51-8

Formula: C₄H₃Cl₂N₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 163.9927

Ref: IN-DA003KO6

4-Amino-2,5-dichloropyrimidine

CAS: 89180-51-8

4-Amino-2,5-dichloropyrimidine

Purity: 95%

Molecular weight: 163.99g/mol

Ref: 54-OR951944

2,5-Dichloropyrimidin-4-amine

CAS: 89180-51-8

Formula: C₄H₃Cl₂N₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 163.99

Ref: 10-F234270