CAS 89182-14-9

3-chloro-5-methylpyrazin-2-amine

Description:

3-Chloro-5-methylpyrazin-2-amine is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a chlorine atom at the 3-position and a methyl group at the 5-position of the pyrazine ring contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. Its chemical reactivity is influenced by the electron-withdrawing nature of the chlorine atom and the electron-donating properties of the amino group, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. 3-Chloro-5-methylpyrazin-2-amine may also have applications in pharmaceuticals or agrochemicals, given the significance of pyrazine derivatives in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₅H₆ClN₃

InChI: InChI=1/C5H6ClN3/c1-3-2-8-5(7)4(6)9-3/h2H,1H3,(H2,7,8)

SMILES: Cc1cnc(c(Cl)n1)N

Synonyms:

• 2-Pyrazinamine, 3-Chloro-5-Methyl-
• 3-Chlor-5-methylpyrazin-2-amin
• 3-Chloro-5-methyl-2-pyrazinamine

3-Chloro-5-methylpyrazin-2-amine

CAS: 89182-14-9

Formula: C₅H₆ClN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 143.5742

Ref: IN-DA003WDX

2-Amino-3-chloro-5-methylpyrazine

CAS: 89182-14-9

2-Amino-3-chloro-5-methylpyrazine

Purity: 97%

Molecular weight: 143.57g/mol

Ref: 54-OR907053

2-Amino-3-chloro-5-methylpyrazine

CAS: 89182-14-9

Formula: C₅H₆ClN₃

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 143.57

Ref: 10-F079882