CymitQuimica logo

CAS 891842-83-4

:

2-Bromo-6-(2-methylpropoxy)pyridine

Description:
2-Bromo-6-(2-methylpropoxy)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 2-position and a 2-methylpropoxy group at the 6-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents, which makes it useful in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. The bromine substituent can participate in nucleophilic substitution reactions, while the alkoxy group can influence the compound's reactivity and solubility. Additionally, the presence of the pyridine ring may impart basicity and potential coordination properties with metal ions. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 2-Bromo-6-(2-methylpropoxy)pyridine is a versatile intermediate in organic synthesis.
Formula:C9H12BrNO
InChI:InChI=1S/C9H12BrNO/c1-7(2)6-12-9-5-3-4-8(10)11-9/h3-5,7H,6H2,1-2H3
InChI key:InChIKey=VOPULGNFFAHCAZ-UHFFFAOYSA-N
SMILES:O(CC(C)C)C=1N=C(Br)C=CC1
Synonyms:
  • Pyridine, 2-bromo-6-(2-methylpropoxy)-
  • 2-Bromo-6-isobutoxypyridine
  • 2-Bromo-6-(2-methylpropoxy)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.