CAS 891843-32-6
:2-Fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid
Description:
2-Fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid is a chemical compound characterized by its unique structure, which includes a fluorine atom and a boron-containing dioxaborolane moiety. This compound typically exhibits properties associated with both aromatic carboxylic acids and organoboron compounds. The presence of the fluorine atom can influence its reactivity and polarity, potentially enhancing its solubility in polar solvents. The dioxaborolane group is known for its stability and ability to participate in various chemical reactions, including cross-coupling reactions, making this compound of interest in synthetic organic chemistry. Additionally, the compound may exhibit specific biological activities, which could be explored for applications in pharmaceuticals or agrochemicals. Its molecular structure suggests potential for interactions with biological targets, and its boron content may facilitate unique reactivity patterns. Overall, 2-Fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid represents a versatile building block in chemical synthesis and research.
Formula:C13H16BFO4
InChI:InChI=1S/C13H16BFO4/c1-12(2)13(3,4)19-14(18-12)8-6-5-7-9(15)10(8)11(16)17/h5-7H,1-4H3,(H,16,17)
InChI key:InChIKey=KNDPQSDAHCFRDB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC=C1F)B2OC(C)(C)C(C)(C)O2
Synonyms:- 2-Fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid
- 2-Fluoro-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid
- Benzoic acid, 2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.