CAS 89185-45-5

7-methyl-2-phenylimidazo[1,2-a]pyridin-3-amine

Description:

7-Methyl-2-phenylimidazo[1,2-a]pyridin-3-amine is a heterocyclic organic compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine core substituted with a methyl group and a phenyl group. This compound typically exhibits properties associated with aromatic amines, such as potential mutagenicity and reactivity due to the presence of the amino group. It is often studied in the context of medicinal chemistry and toxicology, particularly for its role in biological systems and potential effects on human health. The imidazo[1,2-a]pyridine framework is known for its presence in various bioactive compounds, contributing to its significance in drug discovery. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many organic compounds, safety precautions should be taken when handling it, given the potential for harmful effects associated with similar structures.

Formula: C₁₄H₁₃N₃

InChI: InChI=1/C14H13N3/c1-10-7-8-17-12(9-10)16-13(14(17)15)11-5-3-2-4-6-11/h2-9H,15H2,1H3

SMILES: Cc1ccn2c(c1)nc(c1ccccc1)c2N

Synonyms:

• Imidazo[1,2-A]Pyridin-3-Amine, 7-Methyl-2-Phenyl-
• 7-Methyl-2-phenylimidazo[1,2-a]pyridin-3-amine

7-methyl-2-phenylimidazo[1,2-{a}]pyridin-3-amine

CAS: 89185-45-5

Purity: 95.0%

Molecular weight: 223.279

Ref: 10-F494853

7-Methyl-2-phenylimidazo[1,2-a]pyridin-3-amine

CAS: 89185-45-5

Versatile small molecule scaffold

Formula: C₁₄H₁₃N₃

Purity: Min. 95%

Molecular weight: 223.27 g/mol

Ref: 3D-PDA18545