CymitQuimica logo

CAS 89185-46-6

:

2-(4-Methoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine

Description:
2-(4-Methoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine, with the CAS number 89185-46-6, is a chemical compound that belongs to the class of imidazo[1,2-a]pyridines. This compound features a fused bicyclic structure that includes both imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of a methoxy group on the phenyl ring enhances its lipophilicity and may influence its biological activity. Additionally, the methyl group at the 7-position of the imidazo ring can affect the compound's steric and electronic characteristics. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, including anti-cancer and anti-inflammatory activities. Its synthesis typically involves multi-step organic reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and chromatography. As with many heterocyclic compounds, its reactivity and interactions with biological systems can be complex, making it a subject of ongoing research in drug development and chemical biology.
Formula:C15H15N3O
InChI:InChI=1S/C15H15N3O/c1-10-7-8-18-13(9-10)17-14(15(18)16)11-3-5-12(19-2)6-4-11/h3-9H,16H2,1-2H3
InChI key:InChIKey=NEXQEGGSXWDIFD-UHFFFAOYSA-N
SMILES:NC1=C(N=C2N1C=CC(C)=C2)C3=CC=C(OC)C=C3
Synonyms:
  • Imidazo[1,2-a]pyridin-3-amine, 2-(4-methoxyphenyl)-7-methyl-
  • 2-(4-Methoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.