CAS 89185-47-7

Imidazo[1,2-a]pyridin-3-amine, 2-(4-fluorophenyl)-8-methyl-

Description:

Imidazo[1,2-a]pyridin-3-amine, 2-(4-fluorophenyl)-8-methyl- is a chemical compound characterized by its unique bicyclic structure that combines an imidazole and a pyridine ring. This compound features an amino group at the 3-position of the imidazo ring, contributing to its potential reactivity and biological activity. The presence of a 4-fluorophenyl group at the 2-position enhances its lipophilicity and may influence its pharmacological properties. Additionally, the methyl group at the 8-position can affect the steric and electronic properties of the molecule, potentially impacting its interactions with biological targets. This compound is of interest in medicinal chemistry due to its structural features, which may confer specific biological activities, making it a candidate for further research in drug development. Its CAS number, 89185-47-7, allows for easy identification and reference in chemical databases. Overall, the combination of these functional groups and structural characteristics makes it a compound of interest in various fields, including pharmaceuticals and organic synthesis.

Formula: C₁₄H₁₂FN₃

InChI: InChI=1S/C14H12FN3/c1-9-3-2-8-18-13(16)12(17-14(9)18)10-4-6-11(15)7-5-10/h2-8H,16H2,1H3

InChI key: InChIKey=OXFDLBOOZOCENF-UHFFFAOYSA-N

SMILES: NC1=C(N=C2N1C=CC=C2C)C3=CC=C(F)C=C3

Synonyms:

• 2-(4-Fluoro-phenyl)-8-methyl-imidazo[1,2-a]pyridin-3-ylamine
• 2-(4-Fluorophenyl)-8-methylimidazo[1,2-a]pyridin-3-amine
• Imidazo[1,2-a]pyridin-3-amine, 2-(4-fluorophenyl)-8-methyl-

2-(4-Fluorophenyl)-8-methylimidazo[1,2-(a)]pyridin-3-amine

CAS: 89185-47-7

Formula: C₁₄H₁₂FN₃

Molecular weight: 241.2636

Ref: IN-DA003WKS

2-(4-fluorophenyl)-8-methylimidazo[1,2-{a}]pyridin-3-amine

CAS: 89185-47-7

Purity: 95.0%

Molecular weight: 241.269

Ref: 10-F495047