CAS 89186-35-6
:L-Tyrosine, N-L-alanyl-, monohydrate
Description:
L-Tyrosine, N-L-alanyl-, monohydrate is a modified amino acid derivative that combines L-tyrosine with an alanine moiety. This compound is characterized by its role as a building block in protein synthesis and its potential applications in nutritional supplements and pharmaceuticals. As a monohydrate, it contains one molecule of water per molecule of the compound, which can influence its solubility and stability. L-Tyrosine itself is a non-essential amino acid that serves as a precursor for neurotransmitters such as dopamine, norepinephrine, and epinephrine, playing a crucial role in various physiological processes, including mood regulation and cognitive function. The presence of the alanine group may enhance its bioavailability or alter its metabolic pathways. This compound is typically white to off-white in appearance and is soluble in water, making it suitable for various formulations. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C12H16N2O4·H2O
InChI:InChI=1S/C12H16N2O4.H2O/c1-7(13)11(16)14-10(12(17)18)6-8-2-4-9(15)5-3-8;/h2-5,7,10,15H,6,13H2,1H3,(H,14,16)(H,17,18);1H2/t7-,10-;/m0./s1
InChI key:InChIKey=ANVDHGUHXGFURD-YUWZRIFDSA-N
SMILES:[C@H](NC([C@H](C)N)=O)(CC1=CC=C(O)C=C1)C(O)=O.O
Synonyms:- L-Tyrosine, N-L-alanyl-, monohydrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
