CAS 89196-95-2

2-(benzofuran-2-yl)-4,5-dihydro-1H-imidazole hydrochloride

Description:

2-(Benzofuran-2-yl)-4,5-dihydro-1H-imidazole hydrochloride is a chemical compound characterized by its unique structure, which includes a benzofuran moiety and an imidazole ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. The presence of the hydrochloride salt form enhances its stability and solubility, which is beneficial for pharmaceutical formulations. The imidazole ring contributes to its potential biological activity, as imidazole derivatives are known for their roles in medicinal chemistry, often exhibiting antimicrobial, antifungal, or anti-inflammatory properties. The compound's molecular structure allows for interactions with biological targets, which can be explored in drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, 2-(benzofuran-2-yl)-4,5-dihydro-1H-imidazole hydrochloride represents a compound of interest in both research and potential therapeutic applications.

Formula: C₁₁H₁₁ClN₂O

InChI: InChI=1/C11H10N2O.ClH/c1-2-4-9-8(3-1)7-10(14-9)11-12-5-6-13-11;/h1-4,7H,5-6H2,(H,12,13);1H

SMILES: c1ccc2c(c1)cc(C1=NCCN1)o2.Cl

RX 801077 (hydrochloride)

CAS: 89196-95-2

Formula: C₁₁H₁₁ClN₂O

Purity: 98%

Molecular weight: 222.6708

Ref: IN-DA003VMH

2-BFI hydrochloride

CAS: 89196-95-2

2-BFI hydrochloride

Purity: ≥98%

Molecular weight: 222.67g/mol

Ref: 54-BUP06351

2-BFI hydrochloride

CAS: 89196-95-2

2-BFI hydrochloride: High-affinity I2 agonist; used in researching stroke and immune disease protection.

Formula: C₁₁H₁₁ClN₂O

Purity: 99.94%

Color and Shape: Solid

Molecular weight: 222.67

Ref: TM-T22492