
CAS 89197-61-5
:2,3-Dihydrobenzo[b]thiophene-2-carbonitrile
Description:
2,3-Dihydrobenzo[b]thiophene-2-carbonitrile is an organic compound characterized by its unique bicyclic structure, which includes a thiophene ring fused to a benzene ring. This compound features a carbonitrile functional group (-C≡N) at the 2-position of the thiophene ring, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the carbonitrile group enhances its polarity and solubility in polar solvents, while the bicyclic structure provides stability and influences its electronic properties. Typically, compounds like this may exhibit interesting biological activities, making them candidates for pharmaceutical research. Additionally, the compound's molecular structure allows for various functionalization possibilities, which can be explored for developing derivatives with enhanced properties. Its CAS number, 89197-61-5, is a unique identifier that facilitates its identification in chemical databases and literature. Overall, 2,3-Dihydrobenzo[b]thiophene-2-carbonitrile is a versatile compound with potential applications in various fields of chemistry.
Formula:C9H7NS
InChI:InChI=1S/C9H7NS/c10-6-8-5-7-3-1-2-4-9(7)11-8/h1-4,8H,5H2
InChI key:InChIKey=PXHBHZRDGJISEL-UHFFFAOYSA-N
SMILES:C(#N)C1CC=2C(S1)=CC=CC2
Synonyms:- 2,3-Dihydrobenzo[b]thiophene-2-carbonitrile
- Benzo[b]thiophene-2-carbonitrile, 2,3-dihydro-
- 2,3-Dihydro-1-benzothiophene-2-carbonitrile
- 2-Cyano-2,3-dihydrobenzothiophene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.