CAS 89198-47-0
:1-Methyl-8-nitropyrene
Description:
1-Methyl-8-nitropyrene is an organic compound belonging to the polycyclic aromatic hydrocarbon (PAH) family, characterized by its complex structure that includes a methyl group and a nitro group attached to a pyrene backbone. This compound is typically a yellow to orange solid and is known for its potential mutagenic and carcinogenic properties, which are common among nitro-substituted PAHs. It is relatively insoluble in water but soluble in organic solvents, making it relevant in environmental chemistry, particularly in studies related to air pollution and the persistence of organic pollutants. The presence of the nitro group enhances its reactivity, allowing it to participate in various chemical reactions, including nitration and reduction processes. Due to its potential health risks, 1-Methyl-8-nitropyrene is of interest in toxicological research, particularly concerning its effects on human health and the environment. Proper handling and disposal are essential to mitigate exposure risks associated with this compound.
Formula:C17H11NO2
InChI:InChI=1S/C17H11NO2/c1-10-2-3-11-4-5-12-6-9-15(18(19)20)14-8-7-13(10)16(11)17(12)14/h2-9H,1H3
InChI key:InChIKey=DSPALPRHMGUNEF-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C3=C4C(C=C2)=C(C)C=CC4=CC=C3C=C1
Synonyms:- 1-Methyl-8-nitropyrene
- Pyrene, 1-methyl-8-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
