CymitQuimica logo

CAS 89200-87-3

:

Tris(1,1-dimethylethyl)ethenylsilane

Description:
Tris(1,1-dimethylethyl)ethenylsilane, with the CAS number 89200-87-3, is an organosilicon compound characterized by its unique structure that includes a silicon atom bonded to three tert-butyl groups and a vinyl group. This compound is typically a colorless to pale yellow liquid, exhibiting low volatility and a relatively high boiling point compared to simpler silanes. It is known for its stability under ambient conditions, making it suitable for various applications in organic synthesis and materials science. The presence of the vinyl group allows for potential reactivity in polymerization processes, while the bulky tert-butyl groups contribute to steric hindrance, influencing its chemical behavior and interactions. Tris(1,1-dimethylethyl)ethenylsilane is often utilized in the formulation of silicone-based materials, sealants, and coatings, where it can enhance properties such as thermal stability and resistance to degradation. As with many organosilicon compounds, safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C14H30Si
InChI:InChI=1S/C14H30Si/c1-11-15(12(2,3)4,13(5,6)7)14(8,9)10/h11H,1H2,2-10H3
InChI key:InChIKey=JJWXYRUDMPLSPT-UHFFFAOYSA-N
SMILES:[Si](C(C)(C)C)(C(C)(C)C)(C(C)(C)C)C=C
Synonyms:
  • Tris(1,1-dimethylethyl)ethenylsilane
  • Silane, tris(1,1-dimethylethyl)ethenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.