CAS 89201-85-4
:3-Bromobenzeneundecanoic acid
Description:
3-Bromobenzeneundecanoic acid, with the CAS number 89201-85-4, is an organic compound characterized by the presence of a bromobenzene moiety and a long-chain undecanoic acid. This compound features a bromine atom attached to the third position of the benzene ring, which influences its reactivity and solubility properties. The undecanoic acid portion contributes to its hydrophobic characteristics due to the long carbon chain, while the aromatic ring provides stability and potential for various chemical interactions. 3-Bromobenzeneundecanoic acid may exhibit properties such as moderate solubility in organic solvents and limited solubility in water, typical of compounds with long hydrocarbon chains. Its structure suggests potential applications in fields such as materials science, pharmaceuticals, and organic synthesis, where the bromine substituent can serve as a site for further chemical modifications. Additionally, the compound's unique characteristics may allow for specific interactions in biological systems, making it of interest in medicinal chemistry and drug design.
Formula:C17H25BrO2
InChI:InChI=1S/C17H25BrO2/c18-16-12-9-11-15(14-16)10-7-5-3-1-2-4-6-8-13-17(19)20/h9,11-12,14H,1-8,10,13H2,(H,19,20)
InChI key:InChIKey=RRXBXGUNMCRNTP-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCC(O)=O)C1=CC(Br)=CC=C1
Synonyms:- Benzeneundecanoic acid, 3-bromo-
- 3-Bromobenzeneundecanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
