CAS 892018-65-4
:5-Bromo-2-chloro-N-(phenylmethyl)benzamide
Description:
5-Bromo-2-chloro-N-(phenylmethyl)benzamide is an organic compound characterized by the presence of a benzamide functional group, which consists of a benzene ring attached to a carbonyl group (C=O) and an amine (NH) moiety. The compound features two halogen substituents: a bromine atom at the 5-position and a chlorine atom at the 2-position of the benzene ring, which can influence its reactivity and physical properties. The N-(phenylmethyl) group indicates that a phenylmethyl (benzyl) substituent is attached to the nitrogen atom of the amide, contributing to the compound's overall hydrophobic character. This structure may impart specific biological activity, making it of interest in medicinal chemistry. The presence of halogens can enhance lipophilicity and potentially affect the compound's interaction with biological targets. Additionally, the compound's molecular weight, solubility, and stability can vary based on environmental conditions, making it essential for researchers to consider these factors in practical applications.
Formula:C14H11BrClNO
InChI:InChI=1S/C14H11BrClNO/c15-11-6-7-13(16)12(8-11)14(18)17-9-10-4-2-1-3-5-10/h1-8H,9H2,(H,17,18)
InChI key:InChIKey=KWPNVANLUVHVKN-UHFFFAOYSA-N
SMILES:C(NCC1=CC=CC=C1)(=O)C2=C(Cl)C=CC(Br)=C2
Synonyms:- 5-Bromo-2-chloro-N-(phenylmethyl)benzamide
- Benzamide, 5-bromo-2-chloro-N-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
