CymitQuimica logo

CAS 89203-60-1

:

1-[(3Z)-4-(3-methoxyphenyl)-4-phenylbut-3-en-1-yl]piperidine-3-carboxylic acid

Description:
1-[(3Z)-4-(3-methoxyphenyl)-4-phenylbut-3-en-1-yl]piperidine-3-carboxylic acid, with CAS number 89203-60-1, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a carboxylic acid functional group. This compound features a substituted butenyl chain that is conjugated with a phenyl group and a methoxyphenyl moiety, contributing to its potential biological activity. The presence of the piperidine ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The (3Z) configuration indicates a specific geometric arrangement around the double bond, which can influence the compound's reactivity and interactions. Additionally, the methoxy group may enhance lipophilicity and affect the compound's solubility and permeability. Overall, this compound's unique structural features may confer specific pharmacological properties, warranting further investigation in drug development and therapeutic applications.
Formula:C23H27NO3
InChI:InChI=1/C23H27NO3/c1-27-21-12-5-10-19(16-21)22(18-8-3-2-4-9-18)13-7-15-24-14-6-11-20(17-24)23(25)26/h2-5,8-10,12-13,16,20H,6-7,11,14-15,17H2,1H3,(H,25,26)/b22-13-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.